C20H20ClN5O — CID 162784532
(3R)-3-[(6-chloro-3-pyridinyl)methyl]-1-(5-pyridin-4-yl-1H-pyrazol-3-yl)azepan-2-one (PubChem CID 162784532) has the molecular formula C20H20ClN5O and a molecular weight of 381.87 g/mol. Its IUPAC name is (3R)-3-[(6-chloro-3-pyridinyl)methyl]-1-(5-pyridin-4-yl-1H-pyrazol-3-yl)azepan-2-one.
| Compound Name | (3R)-3-[(6-chloro-3-pyridinyl)methyl]-1-(5-pyridin-4-yl-1H-pyrazol-3-yl)azepan-2-one |
|---|---|
| PubChem CID | 162784532 |
| Molecular Formula | C20H20ClN5O |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (3R)-3-[(6-chloro-3-pyridinyl)methyl]-1-(5-pyridin-4-yl-1H-pyrazol-3-yl)azepan-2-one |
| SMILES | O=C1[C@@H](Cc2ccc(Cl)nc2)CCCCN1c1cc(-c2ccncc2)[nH]n1 |
| InChI | InChI=1S/C20H20ClN5O/c21-18-5-4-14(13-23-18)11-16-3-1-2-10-26(20(16)27)19-12-17(24-25-19)15-6-8-22-9-7-15/h4-9,12-13,16H,1-3,10-11H2,(H,24,25)/t16-/m1/s1 |
| InChIKey | LNSSYQVPJIBAIH-MRXNPFEDSA-N |
| XLogP | 3.90 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|