C15H26O5 — CID 162784704
4,4,12,12-tetramethyl-7-propan-2-yl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane (PubChem CID 162784704) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is 4,4,12,12-tetramethyl-7-propan-2-yl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane.
| Compound Name | 4,4,12,12-tetramethyl-7-propan-2-yl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 162784704 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 4,4,12,12-tetramethyl-7-propan-2-yl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
| SMILES | CC(C)C1OC2COC(C)(C)OC2C2OC(C)(C)OC12 |
| InChI | InChI=1S/C15H26O5/c1-8(2)10-12-13(20-15(5,6)19-12)11-9(17-10)7-16-14(3,4)18-11/h8-13H,7H2,1-6H3 |
| InChIKey | JEFINWIZSUZPJH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |