C17H20F3N3O5S — CID 162784730
(4R)-2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-N-[(1R)-4,4,4-trifluoro-1-(4-methoxy-6-oxopyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide (PubChem CID 162784730) has the molecular formula C17H20F3N3O5S and a molecular weight of 435.42 g/mol. Its IUPAC name is (4R)-2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-N-[(1R)-4,4,4-trifluoro-1-(4-methoxy-6-oxopyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide.
| Compound Name | (4R)-2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-N-[(1R)-4,4,4-trifluoro-1-(4-methoxy-6-oxopyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 162784730 |
| Molecular Formula | C17H20F3N3O5S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (4R)-2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-N-[(1R)-4,4,4-trifluoro-1-(4-methoxy-6-oxopyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
| SMILES | COc1cc([C@@H](CCC(F)(F)F)NC(=O)[C@]2(C)CSC(/C(C)=N\O)=N2)oc(=O)c1 |
| InChI | InChI=1S/C17H20F3N3O5S/c1-9(23-26)14-22-16(2,8-29-14)15(25)21-11(4-5-17(18,19)20)12-6-10(27-3)7-13(24)28-12/h6-7,11,26H,4-5,8H2,1-3H3,(H,21,25)/b23-9-/t11-,16+/m1/s1 |
| InChIKey | ICZHIZIAMRPQQS-CKJZOAMASA-N |
| XLogP | 2.90 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|