C22H32N2O5S — CID 162784751
(4R)-2-(1,1-diethoxyethyl)-N-[(1R)-1-(4-ethenyl-6-oxopyran-2-yl)butyl]-4-methyl-5H-1,3-thiazole-4-carboxamide (PubChem CID 162784751) has the molecular formula C22H32N2O5S and a molecular weight of 436.57 g/mol. Its IUPAC name is (4R)-2-(1,1-diethoxyethyl)-N-[(1R)-1-(4-ethenyl-6-oxopyran-2-yl)butyl]-4-methyl-5H-1,3-thiazole-4-carboxamide.
| Compound Name | (4R)-2-(1,1-diethoxyethyl)-N-[(1R)-1-(4-ethenyl-6-oxopyran-2-yl)butyl]-4-methyl-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 162784751 |
| Molecular Formula | C22H32N2O5S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (4R)-2-(1,1-diethoxyethyl)-N-[(1R)-1-(4-ethenyl-6-oxopyran-2-yl)butyl]-4-methyl-5H-1,3-thiazole-4-carboxamide |
| SMILES | C=Cc1cc([C@@H](CCC)NC(=O)[C@]2(C)CSC(C(C)(OCC)OCC)=N2)oc(=O)c1 |
| InChI | InChI=1S/C22H32N2O5S/c1-7-11-16(17-12-15(8-2)13-18(25)29-17)23-19(26)21(5)14-30-20(24-21)22(6,27-9-3)28-10-4/h8,12-13,16H,2,7,9-11,14H2,1,3-6H3,(H,23,26)/t16-,21+/m1/s1 |
| InChIKey | BUTCEVAYSFBRCS-IERDGZPVSA-N |
| XLogP | 3.93 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|