C24H34N4O4 — CID 162785596
2-[3-(2-ethoxyethoxy)propylamino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide (PubChem CID 162785596) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[3-(2-ethoxyethoxy)propylamino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide.
| Compound Name | 2-[3-(2-ethoxyethoxy)propylamino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
|---|---|
| PubChem CID | 162785596 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 2-[3-(2-ethoxyethoxy)propylamino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
| SMILES | CCOCCOCCCNc1cc(-n2nc(C)c3c2CC(C)(C)CC3=O)ccc1C(N)=O |
| InChI | InChI=1S/C24H34N4O4/c1-5-31-11-12-32-10-6-9-26-19-13-17(7-8-18(19)23(25)30)28-20-14-24(3,4)15-21(29)22(20)16(2)27-28/h7-8,13,26H,5-6,9-12,14-15H2,1-4H3,(H2,25,30) |
| InChIKey | OEFKGACEISQRRB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|