C21H42P2 — CID 162785631
(2R,5R)-1-[1-[(2R,5R)-2,5-diethylphospholan-1-yl]-3-methylbutyl]-2,5-diethylphospholane (PubChem CID 162785631) has the molecular formula C21H42P2 and a molecular weight of 356.51 g/mol. Its IUPAC name is (2R,5R)-1-[1-[(2R,5R)-2,5-diethylphospholan-1-yl]-3-methylbutyl]-2,5-diethylphospholane.
| Compound Name | (2R,5R)-1-[1-[(2R,5R)-2,5-diethylphospholan-1-yl]-3-methylbutyl]-2,5-diethylphospholane |
|---|---|
| PubChem CID | 162785631 |
| Molecular Formula | C21H42P2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | (2R,5R)-1-[1-[(2R,5R)-2,5-diethylphospholan-1-yl]-3-methylbutyl]-2,5-diethylphospholane |
| SMILES | CC[C@@H]1CC[C@@H](CC)P1C(CC(C)C)P1[C@H](CC)CC[C@H]1CC |
| InChI | InChI=1S/C21H42P2/c1-7-17-11-12-18(8-2)22(17)21(15-16(5)6)23-19(9-3)13-14-20(23)10-4/h16-21H,7-15H2,1-6H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | KWSFIRRBNVIBSZ-UAFMIMERSA-N |
| XLogP | 8.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|