C30H49N3 — CID 162786419
(6E,10E,14E,18E)-1-azido-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene (PubChem CID 162786419) has the molecular formula C30H49N3 and a molecular weight of 451.74 g/mol. Its IUPAC name is (6E,10E,14E,18E)-1-azido-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene.
| Compound Name | (6E,10E,14E,18E)-1-azido-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene |
|---|---|
| PubChem CID | 162786419 |
| Molecular Formula | C30H49N3 |
| Molecular Weight | 451.74 g/mol |
| Exact Mass | 451.39 |
| IUPAC Name | (6E,10E,14E,18E)-1-azido-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)CN=[N+]=[N-] |
| InChI | InChI=1S/C30H49N3/c1-25(2)14-10-17-28(5)20-11-18-26(3)15-8-9-16-27(4)19-12-21-29(6)22-13-23-30(7)24-32-33-31/h14-16,20-21,23H,8-13,17-19,22,24H2,1-7H3/b26-15+,27-16+,28-20+,29-21+,30-23? |
| InChIKey | GGNRQCRXUIVGHN-MXRMWZFFSA-N |
| XLogP | 10.90 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.74 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|