C10H18O4S — CID 162786700
(2R,3S,4R)-2-(hydroxymethyl)-6-(2-methylprop-2-enylsulfanyl)oxane-3,4-diol (PubChem CID 162786700) has the molecular formula C10H18O4S and a molecular weight of 234.32 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-6-(2-methylprop-2-enylsulfanyl)oxane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-6-(2-methylprop-2-enylsulfanyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 162786700 |
| Molecular Formula | C10H18O4S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-6-(2-methylprop-2-enylsulfanyl)oxane-3,4-diol |
| SMILES | C=C(C)CSC1C[C@@H](O)[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C10H18O4S/c1-6(2)5-15-9-3-7(12)10(13)8(4-11)14-9/h7-13H,1,3-5H2,2H3/t7-,8-,9?,10+/m1/s1 |
| InChIKey | SRMAICNYLATZCA-VYQDEHIVSA-N |
| XLogP | 0.12 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|