C14H26O7S — CID 162786749
(2R,3R,4S,5R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-(2-methylprop-2-enylsulfonyl)oxane (PubChem CID 162786749) has the molecular formula C14H26O7S and a molecular weight of 338.42 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-(2-methylprop-2-enylsulfonyl)oxane.
| Compound Name | (2R,3R,4S,5R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-(2-methylprop-2-enylsulfonyl)oxane |
|---|---|
| PubChem CID | 162786749 |
| Molecular Formula | C14H26O7S |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (2R,3R,4S,5R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-(2-methylprop-2-enylsulfonyl)oxane |
| SMILES | C=C(C)CS(=O)(=O)C1O[C@H](COC)[C@@H](OC)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C14H26O7S/c1-9(2)8-22(15,16)14-13(20-6)12(19-5)11(18-4)10(21-14)7-17-3/h10-14H,1,7-8H2,2-6H3/t10-,11-,12+,13-,14?/m1/s1 |
| InChIKey | WXMNZFOPPYUQNZ-RQICVUQASA-N |
| XLogP | 0.39 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|