C10H18O5S — CID 162786761
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-(2-methylprop-2-enylsulfanyl)oxane-3,4,5-triol (PubChem CID 162786761) has the molecular formula C10H18O5S and a molecular weight of 250.32 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(hydroxymethyl)-6-(2-methylprop-2-enylsulfanyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-(2-methylprop-2-enylsulfanyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162786761 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-(2-methylprop-2-enylsulfanyl)oxane-3,4,5-triol |
| SMILES | C=C(C)CSC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18O5S/c1-5(2)4-16-10-9(14)8(13)7(12)6(3-11)15-10/h6-14H,1,3-4H2,2H3/t6-,7-,8+,9-,10?/m1/s1 |
| InChIKey | BNJJIZKTNAJOKI-ZKZCYXTQSA-N |
| XLogP | -0.90 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|