C15H24O2 — CID 162786792
(1R,6R,7R,11R)-11-hydroxy-7,10,10-trimethyltricyclo[4.3.3.01,6]dodecan-3-one (PubChem CID 162786792) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1R,6R,7R,11R)-11-hydroxy-7,10,10-trimethyltricyclo[4.3.3.01,6]dodecan-3-one.
| Compound Name | (1R,6R,7R,11R)-11-hydroxy-7,10,10-trimethyltricyclo[4.3.3.01,6]dodecan-3-one |
|---|---|
| PubChem CID | 162786792 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1R,6R,7R,11R)-11-hydroxy-7,10,10-trimethyltricyclo[4.3.3.01,6]dodecan-3-one |
| SMILES | C[C@@H]1CC[C@@]23CC(=O)CC[C@@]12C[C@@H](O)C3(C)C |
| InChI | InChI=1S/C15H24O2/c1-10-4-7-15-8-11(16)5-6-14(10,15)9-12(17)13(15,2)3/h10,12,17H,4-9H2,1-3H3/t10-,12-,14-,15+/m1/s1 |
| InChIKey | QWMYPJKSEDQWBV-LTZCYQRMSA-N |
| XLogP | 2.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |