C13H18O2 — CID 162786809
4-[2-(3,3-dimethyloxiran-2-yl)ethyl]-4-methylcyclohexa-2,5-dien-1-one (PubChem CID 162786809) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-[2-(3,3-dimethyloxiran-2-yl)ethyl]-4-methylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-[2-(3,3-dimethyloxiran-2-yl)ethyl]-4-methylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 162786809 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 4-[2-(3,3-dimethyloxiran-2-yl)ethyl]-4-methylcyclohexa-2,5-dien-1-one |
| SMILES | CC1(CCC2OC2(C)C)C=CC(=O)C=C1 |
| InChI | InChI=1S/C13H18O2/c1-12(2)11(15-12)6-9-13(3)7-4-10(14)5-8-13/h4-5,7-8,11H,6,9H2,1-3H3 |
| InChIKey | XBXBPXFOOGWMEU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|