C16H22O2 — CID 162786818
(3R,7R)-7-[(3,3-dimethyloxiran-2-yl)methyl]-3,7-dimethyl-2,3-dihydro-1H-inden-4-one (PubChem CID 162786818) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (3R,7R)-7-[(3,3-dimethyloxiran-2-yl)methyl]-3,7-dimethyl-2,3-dihydro-1H-inden-4-one.
| Compound Name | (3R,7R)-7-[(3,3-dimethyloxiran-2-yl)methyl]-3,7-dimethyl-2,3-dihydro-1H-inden-4-one |
|---|---|
| PubChem CID | 162786818 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (3R,7R)-7-[(3,3-dimethyloxiran-2-yl)methyl]-3,7-dimethyl-2,3-dihydro-1H-inden-4-one |
| SMILES | C[C@@H]1CCC2=C1C(=O)C=C[C@@]2(C)CC1OC1(C)C |
| InChI | InChI=1S/C16H22O2/c1-10-5-6-11-14(10)12(17)7-8-16(11,4)9-13-15(2,3)18-13/h7-8,10,13H,5-6,9H2,1-4H3/t10-,13?,16+/m1/s1 |
| InChIKey | BWDIECNYWVGCPL-CTMQCXFESA-N |
| XLogP | 3.43 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|