C15H24O2 — CID 162786823
(3aR,6aR,9aR)-2-hydroxy-1,1,3a-trimethyl-2,3,4,5,6a,7,8,9-octahydrocyclopenta[d]inden-6-one (PubChem CID 162786823) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (3aR,6aR,9aR)-2-hydroxy-1,1,3a-trimethyl-2,3,4,5,6a,7,8,9-octahydrocyclopenta[d]inden-6-one.
| Compound Name | (3aR,6aR,9aR)-2-hydroxy-1,1,3a-trimethyl-2,3,4,5,6a,7,8,9-octahydrocyclopenta[d]inden-6-one |
|---|---|
| PubChem CID | 162786823 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (3aR,6aR,9aR)-2-hydroxy-1,1,3a-trimethyl-2,3,4,5,6a,7,8,9-octahydrocyclopenta[d]inden-6-one |
| SMILES | CC1(C)C(O)C[C@@]2(C)CCC(=O)[C@@H]3CCC[C@]312 |
| InChI | InChI=1S/C15H24O2/c1-13(2)12(17)9-14(3)8-6-11(16)10-5-4-7-15(10,13)14/h10,12,17H,4-9H2,1-3H3/t10-,12?,14+,15-/m0/s1 |
| InChIKey | GXPCESJRNSBMKL-KZQPRWOGSA-N |
| XLogP | 2.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |