C20H36O3Si — CID 162786843
(2S,3aS,7aR)-7a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-hydroxy-3,3-dimethyl-1,2,3a,4-tetrahydroinden-5-one (PubChem CID 162786843) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is (2S,3aS,7aR)-7a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-hydroxy-3,3-dimethyl-1,2,3a,4-tetrahydroinden-5-one.
| Compound Name | (2S,3aS,7aR)-7a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-hydroxy-3,3-dimethyl-1,2,3a,4-tetrahydroinden-5-one |
|---|---|
| PubChem CID | 162786843 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (2S,3aS,7aR)-7a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-hydroxy-3,3-dimethyl-1,2,3a,4-tetrahydroinden-5-one |
| SMILES | CC1(C)[C@H]2CC(=O)C=C[C@@]2(CCCO[Si](C)(C)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C20H36O3Si/c1-18(2,3)24(6,7)23-12-8-10-20-11-9-15(21)13-16(20)19(4,5)17(22)14-20/h9,11,16-17,22H,8,10,12-14H2,1-7H3/t16-,17+,20+/m1/s1 |
| InChIKey | NYLBRCXOMQKDPT-UWVAXJGDSA-N |
| XLogP | 4.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|