C18H32O3Si — CID 162786852
(2S,3aS,7aS)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-3,3-dimethyl-1,2,3a,4-tetrahydroinden-5-one (PubChem CID 162786852) has the molecular formula C18H32O3Si and a molecular weight of 324.54 g/mol. Its IUPAC name is (2S,3aS,7aS)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-3,3-dimethyl-1,2,3a,4-tetrahydroinden-5-one.
| Compound Name | (2S,3aS,7aS)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-3,3-dimethyl-1,2,3a,4-tetrahydroinden-5-one |
|---|---|
| PubChem CID | 162786852 |
| Molecular Formula | C18H32O3Si |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (2S,3aS,7aS)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-3,3-dimethyl-1,2,3a,4-tetrahydroinden-5-one |
| SMILES | CC1(C)[C@H]2CC(=O)C=C[C@@]2(CO[Si](C)(C)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C18H32O3Si/c1-16(2,3)22(6,7)21-12-18-9-8-13(19)10-14(18)17(4,5)15(20)11-18/h8-9,14-15,20H,10-12H2,1-7H3/t14-,15+,18+/m1/s1 |
| InChIKey | BGRFMRVVGSNJRM-VKJFTORMSA-N |
| XLogP | 3.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|