C20H32O2Si — CID 162786860
(3R,7R)-7-[(E)-but-2-enyl]-3-[tert-butyl(dimethyl)silyl]oxy-7-methyl-2,3-dihydro-1H-inden-4-one (PubChem CID 162786860) has the molecular formula C20H32O2Si and a molecular weight of 332.56 g/mol. Its IUPAC name is (3R,7R)-7-[(E)-but-2-enyl]-3-[tert-butyl(dimethyl)silyl]oxy-7-methyl-2,3-dihydro-1H-inden-4-one.
| Compound Name | (3R,7R)-7-[(E)-but-2-enyl]-3-[tert-butyl(dimethyl)silyl]oxy-7-methyl-2,3-dihydro-1H-inden-4-one |
|---|---|
| PubChem CID | 162786860 |
| Molecular Formula | C20H32O2Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | (3R,7R)-7-[(E)-but-2-enyl]-3-[tert-butyl(dimethyl)silyl]oxy-7-methyl-2,3-dihydro-1H-inden-4-one |
| SMILES | C/C=C/C[C@]1(C)C=CC(=O)C2=C1CC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32O2Si/c1-8-9-13-20(5)14-12-16(21)18-15(20)10-11-17(18)22-23(6,7)19(2,3)4/h8-9,12,14,17H,10-11,13H2,1-7H3/b9-8+/t17-,20-/m1/s1 |
| InChIKey | ILUHKJOFKLQCNF-DBHZWCICSA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|