C20H34O3Si — CID 162786870
(1S,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-7a-[(3,3-dimethyloxiran-2-yl)methyl]-2,3,6,7-tetrahydro-1H-inden-5-one (PubChem CID 162786870) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (1S,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-7a-[(3,3-dimethyloxiran-2-yl)methyl]-2,3,6,7-tetrahydro-1H-inden-5-one.
| Compound Name | (1S,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-7a-[(3,3-dimethyloxiran-2-yl)methyl]-2,3,6,7-tetrahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 162786870 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (1S,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-7a-[(3,3-dimethyloxiran-2-yl)methyl]-2,3,6,7-tetrahydro-1H-inden-5-one |
| SMILES | CC1(C)OC1C[C@]12CCC(=O)C=C1CC[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O3Si/c1-18(2,3)24(6,7)23-16-9-8-14-12-15(21)10-11-20(14,16)13-17-19(4,5)22-17/h12,16-17H,8-11,13H2,1-7H3/t16-,17?,20+/m0/s1 |
| InChIKey | HXPSFQLOVRWIDK-YKBQRGLWSA-N |
| XLogP | 5.01 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|