C45H44N16 — CID 162786919
(3,5-dimethyl-1H-pyrazol-4-yl)-[4-[tris[4-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]phenyl]methyl]phenyl]diazene (PubChem CID 162786919) has the molecular formula C45H44N16 and a molecular weight of 808.96 g/mol. Its IUPAC name is (3,5-dimethyl-1H-pyrazol-4-yl)-[4-[tris[4-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]phenyl]methyl]phenyl]diazene.
| Compound Name | (3,5-dimethyl-1H-pyrazol-4-yl)-[4-[tris[4-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]phenyl]methyl]phenyl]diazene |
|---|---|
| PubChem CID | 162786919 |
| Molecular Formula | C45H44N16 |
| Molecular Weight | 808.96 g/mol |
| Exact Mass | 808.39 |
| IUPAC Name | (3,5-dimethyl-1H-pyrazol-4-yl)-[4-[tris[4-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]phenyl]methyl]phenyl]diazene |
| SMILES | Cc1n[nH]c(C)c1/N=N/c1ccc(C(c2ccc(/N=N/c3c(C)n[nH]c3C)cc2)(c2ccc(/N=N/c3c(C)n[nH]c3C)cc2)c2ccc(/N=N/c3c(C)n[nH]c3C)cc2)cc1 |
| InChI | InChI=1S/C45H44N16/c1-25-41(26(2)47-46-25)58-54-37-17-9-33(10-18-37)45(34-11-19-38(20-12-34)55-59-42-27(3)48-49-28(42)4,35-13-21-39(22-14-35)56-60-43-29(5)50-51-30(43)6)36-15-23-40(24-16-36)57-61-44-31(7)52-53-32(44)8/h9-24H,1-8H3,(H,46,47)(H,48,49)(H,50,51)(H,52,53)/b58-54+,59-55+,60-56+,61-57+ |
| InChIKey | FAOUEBJEAFTSQH-CYMDEEQTSA-N |
| XLogP | 13.09 |
| TPSA | 213.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.96 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|