C27H23FN2O3 — CID 162787156
2-(4-fluorophenyl)-4-methyl-6-oxo-1-N,3-N-diphenylcyclohex-4-ene-1,3-dicarboxamide (PubChem CID 162787156) has the molecular formula C27H23FN2O3 and a molecular weight of 442.49 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-methyl-6-oxo-1-N,3-N-diphenylcyclohex-4-ene-1,3-dicarboxamide.
| Compound Name | 2-(4-fluorophenyl)-4-methyl-6-oxo-1-N,3-N-diphenylcyclohex-4-ene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 162787156 |
| Molecular Formula | C27H23FN2O3 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-(4-fluorophenyl)-4-methyl-6-oxo-1-N,3-N-diphenylcyclohex-4-ene-1,3-dicarboxamide |
| SMILES | CC1=CC(=O)C(C(=O)Nc2ccccc2)C(c2ccc(F)cc2)C1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H23FN2O3/c1-17-16-22(31)25(27(33)30-21-10-6-3-7-11-21)24(18-12-14-19(28)15-13-18)23(17)26(32)29-20-8-4-2-5-9-20/h2-16,23-25H,1H3,(H,29,32)(H,30,33) |
| InChIKey | MNAJMYPSQAAHPQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|