C19H22ClN — CID 162787257
4-(4-chlorophenyl)-1,2,2,4-tetramethyl-3H-quinoline (PubChem CID 162787257) has the molecular formula C19H22ClN and a molecular weight of 299.85 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1,2,2,4-tetramethyl-3H-quinoline.
| Compound Name | 4-(4-chlorophenyl)-1,2,2,4-tetramethyl-3H-quinoline |
|---|---|
| PubChem CID | 162787257 |
| Molecular Formula | C19H22ClN |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 4-(4-chlorophenyl)-1,2,2,4-tetramethyl-3H-quinoline |
| SMILES | CN1c2ccccc2C(C)(c2ccc(Cl)cc2)CC1(C)C |
| InChI | InChI=1S/C19H22ClN/c1-18(2)13-19(3,14-9-11-15(20)12-10-14)16-7-5-6-8-17(16)21(18)4/h5-12H,13H2,1-4H3 |
| InChIKey | GCVBFWGTBOWRBT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |