C30H24ClFN2O3S — CID 162787263
(5Z)-3-benzyl-5-[9-(4-chlorophenyl)-6-fluoro-9,11,11-trimethyl-2-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-ylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 162787263) has the molecular formula C30H24ClFN2O3S and a molecular weight of 547.05 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-[9-(4-chlorophenyl)-6-fluoro-9,11,11-trimethyl-2-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-ylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-benzyl-5-[9-(4-chlorophenyl)-6-fluoro-9,11,11-trimethyl-2-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-ylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 162787263 |
| Molecular Formula | C30H24ClFN2O3S |
| Molecular Weight | 547.05 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | (5Z)-3-benzyl-5-[9-(4-chlorophenyl)-6-fluoro-9,11,11-trimethyl-2-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-ylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC1(c2ccc(Cl)cc2)CC(C)(C)N2C(=O)/C(=C3\SC(=O)N(Cc4ccccc4)C3=O)c3cc(F)cc1c32 |
| InChI | InChI=1S/C30H24ClFN2O3S/c1-29(2)16-30(3,18-9-11-19(31)12-10-18)22-14-20(32)13-21-23(26(35)34(29)24(21)22)25-27(36)33(28(37)38-25)15-17-7-5-4-6-8-17/h4-14H,15-16H2,1-3H3/b25-23- |
| InChIKey | KBJNPZJSYLRESA-BZZOAKBMSA-N |
| XLogP | 6.92 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.05 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|