C15H15FN2O2 — CID 162787699
(4S)-4-(3,6-dihydro-2H-pyridine-1-carbonyl)-6-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 162787699) has the molecular formula C15H15FN2O2 and a molecular weight of 274.29 g/mol. Its IUPAC name is (4S)-4-(3,6-dihydro-2H-pyridine-1-carbonyl)-6-fluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | (4S)-4-(3,6-dihydro-2H-pyridine-1-carbonyl)-6-fluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 162787699 |
| Molecular Formula | C15H15FN2O2 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (4S)-4-(3,6-dihydro-2H-pyridine-1-carbonyl)-6-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1C[C@H](C(=O)N2CC=CCC2)c2cc(F)ccc2N1 |
| InChI | InChI=1S/C15H15FN2O2/c16-10-4-5-13-11(8-10)12(9-14(19)17-13)15(20)18-6-2-1-3-7-18/h1-2,4-5,8,12H,3,6-7,9H2,(H,17,19)/t12-/m0/s1 |
| InChIKey | ZQDYWCGZVRLFKT-LBPRGKRZSA-N |
| XLogP | 2.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|