C16H22N2O4 — CID 162787766
ethyl (E,4S)-5-[(3S)-2-oxopyrrolidin-3-yl]-4-(pent-4-ynoylamino)pent-2-enoate (PubChem CID 162787766) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is ethyl (E,4S)-5-[(3S)-2-oxopyrrolidin-3-yl]-4-(pent-4-ynoylamino)pent-2-enoate.
| Compound Name | ethyl (E,4S)-5-[(3S)-2-oxopyrrolidin-3-yl]-4-(pent-4-ynoylamino)pent-2-enoate |
|---|---|
| PubChem CID | 162787766 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | ethyl (E,4S)-5-[(3S)-2-oxopyrrolidin-3-yl]-4-(pent-4-ynoylamino)pent-2-enoate |
| SMILES | C#CCCC(=O)N[C@H](/C=C/C(=O)OCC)C[C@@H]1CCNC1=O |
| InChI | InChI=1S/C16H22N2O4/c1-3-5-6-14(19)18-13(7-8-15(20)22-4-2)11-12-9-10-17-16(12)21/h1,7-8,12-13H,4-6,9-11H2,2H3,(H,17,21)(H,18,19)/b8-7+/t12-,13+/m0/s1 |
| InChIKey | ZULBYUIYQQNREC-AHYBDNRGSA-N |
| XLogP | 0.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|