C14H18O8 — CID 162787795
trimethyl 4-ethyl-4-methyl-2-oxo-3H-pyran-3,5,6-tricarboxylate (PubChem CID 162787795) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is trimethyl 4-ethyl-4-methyl-2-oxo-3H-pyran-3,5,6-tricarboxylate.
| Compound Name | trimethyl 4-ethyl-4-methyl-2-oxo-3H-pyran-3,5,6-tricarboxylate |
|---|---|
| PubChem CID | 162787795 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | trimethyl 4-ethyl-4-methyl-2-oxo-3H-pyran-3,5,6-tricarboxylate |
| SMILES | CCC1(C)C(C(=O)OC)=C(C(=O)OC)OC(=O)C1C(=O)OC |
| InChI | InChI=1S/C14H18O8/c1-6-14(2)7(10(15)19-3)9(13(18)21-5)22-12(17)8(14)11(16)20-4/h8H,6H2,1-5H3 |
| InChIKey | IYVRJYIVWAGZED-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|