About 5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide
5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide (PubChem CID 162787899) has the molecular formula C24H24INO2
and a molecular weight of 485.37 g/mol. Its IUPAC name is 5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide.
Molecular Properties
| Compound Name | 5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide |
| PubChem CID | 162787899 |
| Molecular Formula | C24H24INO2 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide |
| SMILES | COc1ccc(/C=C/C2=[N+](C)c3ccc4ccccc4c3C2(C)C)c(O)c1.[I-] |
| InChI | InChI=1S/C24H23NO2.HI/c1-24(2)22(14-11-17-9-12-18(27-4)15-21(17)26)25(3)20-13-10-16-7-5-6-8-19(16)23(20)24;/h5-15H,1-4H3;1H |
| InChIKey | INTZSAICSHAPDW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide?
The IUPAC name of 5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide (CID 162787899) is 5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide.
What is the SMILES notation for 5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide?
The canonical SMILES for 5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide is COc1ccc(/C=C/C2=[N+](C)c3ccc4ccccc4c3C2(C)C)c(O)c1.[I-].
What is the InChIKey of 5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide?
The InChIKey is INTZSAICSHAPDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO2.HI/c1-24(2)22(14-11-17-9-12-18(27-4)15-21(17)26)25(3)20-13-10-16-7-5-6-8-19(16)23(20)24;/h5-15H,1-4H3;1H.
What are the key properties of 5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide?
5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide has a molecular weight of 485.37 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol iodide is sourced from PubChem (CID 162787899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).