C30H30N4O5 — CID 162788054
6,7-bis(2-methoxyethoxy)-N-(3-methyl-4-quinolin-8-yloxyphenyl)quinazolin-4-amine (PubChem CID 162788054) has the molecular formula C30H30N4O5 and a molecular weight of 526.59 g/mol. Its IUPAC name is 6,7-bis(2-methoxyethoxy)-N-(3-methyl-4-quinolin-8-yloxyphenyl)quinazolin-4-amine.
| Compound Name | 6,7-bis(2-methoxyethoxy)-N-(3-methyl-4-quinolin-8-yloxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 162788054 |
| Molecular Formula | C30H30N4O5 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 6,7-bis(2-methoxyethoxy)-N-(3-methyl-4-quinolin-8-yloxyphenyl)quinazolin-4-amine |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(Oc4cccc5cccnc45)c(C)c3)c2cc1OCCOC |
| InChI | InChI=1S/C30H30N4O5/c1-20-16-22(9-10-25(20)39-26-8-4-6-21-7-5-11-31-29(21)26)34-30-23-17-27(37-14-12-35-2)28(38-15-13-36-3)18-24(23)32-19-33-30/h4-11,16-19H,12-15H2,1-3H3,(H,32,33,34) |
| InChIKey | FJLJZVIKDMKMEN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|