C31H32N4O5 — CID 162788068
N-(3,5-dimethyl-4-quinolin-8-yloxyphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine (PubChem CID 162788068) has the molecular formula C31H32N4O5 and a molecular weight of 540.62 g/mol. Its IUPAC name is N-(3,5-dimethyl-4-quinolin-8-yloxyphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine.
| Compound Name | N-(3,5-dimethyl-4-quinolin-8-yloxyphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 162788068 |
| Molecular Formula | C31H32N4O5 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | N-(3,5-dimethyl-4-quinolin-8-yloxyphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine |
| SMILES | COCCOc1cc2ncnc(Nc3cc(C)c(Oc4cccc5cccnc45)c(C)c3)c2cc1OCCOC |
| InChI | InChI=1S/C31H32N4O5/c1-20-15-23(16-21(2)30(20)40-26-9-5-7-22-8-6-10-32-29(22)26)35-31-24-17-27(38-13-11-36-3)28(39-14-12-37-4)18-25(24)33-19-34-31/h5-10,15-19H,11-14H2,1-4H3,(H,33,34,35) |
| InChIKey | ZPVLBMJMVUWCNR-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|