About 5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine
5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine (PubChem CID 162788489) has the molecular formula C6H5N3O
and a molecular weight of 135.13 g/mol. Its IUPAC name is 5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine.
Molecular Properties
| Compound Name | 5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine |
| PubChem CID | 162788489 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine |
| SMILES | [H]/N=C/c1[nH]cc2cnoc12 |
| InChI | InChI=1S/C6H5N3O/c7-1-5-6-4(2-8-5)3-9-10-6/h1-3,7-8H/b7-1+ |
| InChIKey | GPGPWEMREFPVSA-LREOWRDNSA-N |
| XLogP | 1.15 |
| TPSA | 65.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine?
The IUPAC name of 5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine (CID 162788489) is 5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine.
What is the SMILES notation for 5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine?
The canonical SMILES for 5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine is [H]/N=C/c1[nH]cc2cnoc12.
What is the InChIKey of 5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine?
The InChIKey is GPGPWEMREFPVSA-LREOWRDNSA-N. The full InChI is InChI=1S/C6H5N3O/c7-1-5-6-4(2-8-5)3-9-10-6/h1-3,7-8H/b7-1+.
What are the key properties of 5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine?
5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine has a molecular weight of 135.13 g/mol, XLogP of 1.15, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrrolo[3,4-d][1,2]oxazol-6-ylmethanimine is sourced from PubChem (CID 162788489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).