About pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine
pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine (PubChem CID 162788780) has the molecular formula C6H5N3O
and a molecular weight of 135.13 g/mol. Its IUPAC name is pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine.
Molecular Properties
| Compound Name | pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine |
| PubChem CID | 162788780 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine |
| SMILES | [H]/N=C/c1cnn2ccoc12 |
| InChI | InChI=1S/C6H5N3O/c7-3-5-4-8-9-1-2-10-6(5)9/h1-4,7H/b7-3+ |
| InChIKey | CNVZBHCWKFFOTK-XVNBXDOJSA-N |
| XLogP | 0.92 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine?
The IUPAC name of pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine (CID 162788780) is pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine.
What is the SMILES notation for pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine?
The canonical SMILES for pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine is [H]/N=C/c1cnn2ccoc12.
What is the InChIKey of pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine?
The InChIKey is CNVZBHCWKFFOTK-XVNBXDOJSA-N. The full InChI is InChI=1S/C6H5N3O/c7-3-5-4-8-9-1-2-10-6(5)9/h1-4,7H/b7-3+.
What are the key properties of pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine?
pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine has a molecular weight of 135.13 g/mol, XLogP of 0.92, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolo[5,1-b][1,3]oxazol-7-ylmethanimine is sourced from PubChem (CID 162788780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).