C19H24O6 — CID 162789985
(6-hydroxy-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-4-yl) 2-(hydroxymethyl)prop-2-enoate (PubChem CID 162789985) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is (6-hydroxy-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-4-yl) 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | (6-hydroxy-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-4-yl) 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 162789985 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (6-hydroxy-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-4-yl) 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OC1CC2(C)C(O)CC=C(C)C2C2OC(=O)C(=C)C12 |
| InChI | InChI=1S/C19H24O6/c1-9-5-6-13(21)19(4)7-12(24-17(22)10(2)8-20)14-11(3)18(23)25-16(14)15(9)19/h5,12-16,20-21H,2-3,6-8H2,1,4H3 |
| InChIKey | SJBLNIUSBRGFNL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|