C21H26O6 — CID 162790907
[(3aR,4R,6Z,10Z,11aR)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (5S)-5-methoxy-2,5-dihydrofuran-3-carboxylate (PubChem CID 162790907) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is [(3aR,4R,6Z,10Z,11aR)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (5S)-5-methoxy-2,5-dihydrofuran-3-carboxylate.
| Compound Name | [(3aR,4R,6Z,10Z,11aR)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (5S)-5-methoxy-2,5-dihydrofuran-3-carboxylate |
|---|---|
| PubChem CID | 162790907 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | [(3aR,4R,6Z,10Z,11aR)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (5S)-5-methoxy-2,5-dihydrofuran-3-carboxylate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(/C)CC/C=C(/C)C[C@@H](OC(=O)C3=C[C@@H](OC)OC3)[C@@H]12 |
| InChI | InChI=1S/C21H26O6/c1-12-6-5-7-13(2)9-17(19-14(3)20(22)26-16(19)8-12)27-21(23)15-10-18(24-4)25-11-15/h7-8,10,16-19H,3,5-6,9,11H2,1-2,4H3/b12-8-,13-7-/t16-,17-,18+,19+/m1/s1 |
| InChIKey | WJDXSSMUMBFJKH-XSOIVKQFSA-N |
| XLogP | 3.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|