C38H55NO5 — CID 162791165
5-[(1R,2S,3S,11S,13S)-11-[(1S)-1-hydroxy-5-methylhexyl]-3-methyl-13-[(3-pentylphenyl)methyl]-5-oxa-10-azatricyclo[8.4.0.02,6]tetradec-6-en-4-ylidene]-4-methoxy-3-methylfuran-2-one (PubChem CID 162791165) has the molecular formula C38H55NO5 and a molecular weight of 605.86 g/mol. Its IUPAC name is 5-[(1R,2S,3S,11S,13S)-11-[(1S)-1-hydroxy-5-methylhexyl]-3-methyl-13-[(3-pentylphenyl)methyl]-5-oxa-10-azatricyclo[8.4.0.02,6]tetradec-6-en-4-ylidene]-4-methoxy-3-methylfuran-2-one.
| Compound Name | 5-[(1R,2S,3S,11S,13S)-11-[(1S)-1-hydroxy-5-methylhexyl]-3-methyl-13-[(3-pentylphenyl)methyl]-5-oxa-10-azatricyclo[8.4.0.02,6]tetradec-6-en-4-ylidene]-4-methoxy-3-methylfuran-2-one |
|---|---|
| PubChem CID | 162791165 |
| Molecular Formula | C38H55NO5 |
| Molecular Weight | 605.86 g/mol |
| Exact Mass | 605.41 |
| IUPAC Name | 5-[(1R,2S,3S,11S,13S)-11-[(1S)-1-hydroxy-5-methylhexyl]-3-methyl-13-[(3-pentylphenyl)methyl]-5-oxa-10-azatricyclo[8.4.0.02,6]tetradec-6-en-4-ylidene]-4-methoxy-3-methylfuran-2-one |
| SMILES | CCCCCc1cccc(C[C@H]2C[C@@H]3[C@H]4C(=CCCN3[C@H]([C@@H](O)CCCC(C)C)C2)OC(=C2OC(=O)C(C)=C2OC)[C@H]4C)c1 |
| InChI | InChI=1S/C38H55NO5/c1-7-8-9-14-27-15-11-16-28(20-27)21-29-22-30(32(40)17-10-13-24(2)3)39-19-12-18-33-34(31(39)23-29)25(4)36(43-33)37-35(42-6)26(5)38(41)44-37/h11,15-16,18,20,24-25,29-32,34,40H,7-10,12-14,17,19,21-23H2,1-6H3/t25-,29+,30-,31+,32-,34-/m0/s1 |
| InChIKey | GUIOJHIMIUQTSG-CMJCPUHNSA-N |
| XLogP | 7.86 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.86 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|