C34H35N3O6S2 — CID 162791911
(4-amino-21-methyl-7',9-dioxospiro[15,16-dithia-5,10-diazatetracyclo[16.4.0.02,7.010,13]docosa-2,4,6,18-tetraene-22,2'-3H-furo[3,2-g]chromene]-21-yl) 2-methylbut-2-enoate (PubChem CID 162791911) has the molecular formula C34H35N3O6S2 and a molecular weight of 645.80 g/mol. Its IUPAC name is (4-amino-21-methyl-7',9-dioxospiro[15,16-dithia-5,10-diazatetracyclo[16.4.0.02,7.010,13]docosa-2,4,6,18-tetraene-22,2'-3H-furo[3,2-g]chromene]-21-yl) 2-methylbut-2-enoate.
| Compound Name | (4-amino-21-methyl-7',9-dioxospiro[15,16-dithia-5,10-diazatetracyclo[16.4.0.02,7.010,13]docosa-2,4,6,18-tetraene-22,2'-3H-furo[3,2-g]chromene]-21-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162791911 |
| Molecular Formula | C34H35N3O6S2 |
| Molecular Weight | 645.80 g/mol |
| Exact Mass | 645.20 |
| IUPAC Name | (4-amino-21-methyl-7',9-dioxospiro[15,16-dithia-5,10-diazatetracyclo[16.4.0.02,7.010,13]docosa-2,4,6,18-tetraene-22,2'-3H-furo[3,2-g]chromene]-21-yl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1(C)CC=C2CSSCC3CCN3C(=O)Cc3cnc(N)cc3C2C12Cc1cc3ccc(=O)oc3cc1O2 |
| InChI | InChI=1S/C34H35N3O6S2/c1-4-19(2)32(40)43-33(3)9-7-21-17-44-45-18-24-8-10-37(24)29(38)12-23-16-36-28(35)13-25(23)31(21)34(33)15-22-11-20-5-6-30(39)41-26(20)14-27(22)42-34/h4-7,11,13-14,16,24,31H,8-10,12,15,17-18H2,1-3H3,(H2,35,36) |
| InChIKey | AQRCUZINRQQULQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.80 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|