C39H51N3O6 — CID 162792037
[5-ethyl-2-(ethylamino)cyclohexyl]methyl 7a-[4-[1-(2-amino-4-pyridinyl)cyclohexyl]-2-(hydroxymethyl)-3-methylbut-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 162792037) has the molecular formula C39H51N3O6 and a molecular weight of 657.85 g/mol. Its IUPAC name is [5-ethyl-2-(ethylamino)cyclohexyl]methyl 7a-[4-[1-(2-amino-4-pyridinyl)cyclohexyl]-2-(hydroxymethyl)-3-methylbut-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | [5-ethyl-2-(ethylamino)cyclohexyl]methyl 7a-[4-[1-(2-amino-4-pyridinyl)cyclohexyl]-2-(hydroxymethyl)-3-methylbut-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 162792037 |
| Molecular Formula | C39H51N3O6 |
| Molecular Weight | 657.85 g/mol |
| Exact Mass | 657.38 |
| IUPAC Name | [5-ethyl-2-(ethylamino)cyclohexyl]methyl 7a-[4-[1-(2-amino-4-pyridinyl)cyclohexyl]-2-(hydroxymethyl)-3-methylbut-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CCNC1CCC(CC)CC1COC(=O)C12OC1(CC(CO)=C(C)CC1(c3ccnc(N)c3)CCCCC1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C39H51N3O6/c1-4-26-13-14-32(41-5-2)27(19-26)24-47-36(46)39-35(45)31-12-8-7-11-30(31)34(44)38(39,48-39)22-28(23-43)25(3)21-37(16-9-6-10-17-37)29-15-18-42-33(40)20-29/h7-8,11-12,15,18,20,26-27,32,41,43H,4-6,9-10,13-14,16-17,19,21-24H2,1-3H3,(H2,40,42) |
| InChIKey | FYLYGUUQWKNSPN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.85 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|