C39H48N3O5- — CID 162792273
6-[3-[4-(2-amino-4-pyridinyl)-1-hydroxy-5-pyrrol-1-id-2-ylpentan-2-yl]oxy-4-hydroxyphenyl]-12-ethyltricyclo[10.3.2.03,9]heptadec-7-en-10-yne-2,4-diol (PubChem CID 162792273) has the molecular formula C39H48N3O5- and a molecular weight of 638.83 g/mol. Its IUPAC name is 6-[3-[4-(2-amino-4-pyridinyl)-1-hydroxy-5-pyrrol-1-id-2-ylpentan-2-yl]oxy-4-hydroxyphenyl]-12-ethyltricyclo[10.3.2.03,9]heptadec-7-en-10-yne-2,4-diol.
| Compound Name | 6-[3-[4-(2-amino-4-pyridinyl)-1-hydroxy-5-pyrrol-1-id-2-ylpentan-2-yl]oxy-4-hydroxyphenyl]-12-ethyltricyclo[10.3.2.03,9]heptadec-7-en-10-yne-2,4-diol |
|---|---|
| PubChem CID | 162792273 |
| Molecular Formula | C39H48N3O5- |
| Molecular Weight | 638.83 g/mol |
| Exact Mass | 638.36 |
| IUPAC Name | 6-[3-[4-(2-amino-4-pyridinyl)-1-hydroxy-5-pyrrol-1-id-2-ylpentan-2-yl]oxy-4-hydroxyphenyl]-12-ethyltricyclo[10.3.2.03,9]heptadec-7-en-10-yne-2,4-diol |
| SMILES | CCC12C#CC3C=CC(c4ccc(O)c(OC(CO)CC(Cc5ccc[n-]5)c5ccnc(N)c5)c4)CC(O)C3C(O)C(CCC1)CC2 |
| InChI | InChI=1S/C39H48N3O5/c1-2-39-14-3-5-26(12-16-39)38(46)37-25(11-15-39)7-8-27(21-34(37)45)28-9-10-33(44)35(22-28)47-32(24-43)20-30(19-31-6-4-17-41-31)29-13-18-42-36(40)23-29/h4,6-10,13,17-18,22-23,25-27,30,32,34,37-38,43-46H,2-3,5,12,14,16,19-21,24H2,1H3,(H2,40,42)/q-1 |
| InChIKey | UYGKPLJXJUCKBO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.83 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|