About 5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide
5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide (PubChem CID 162792864) has the molecular formula C17H27NO5
and a molecular weight of 325.41 g/mol. Its IUPAC name is 5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide.
Molecular Properties
| Compound Name | 5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide |
| PubChem CID | 162792864 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide |
| SMILES | COCC1CC(NC(=O)c2cc(C(C)(C)C)oc2C)C(O)C1O |
| InChI | InChI=1S/C17H27NO5/c1-9-11(7-13(23-9)17(2,3)4)16(21)18-12-6-10(8-22-5)14(19)15(12)20/h7,10,12,14-15,19-20H,6,8H2,1-5H3,(H,18,21) |
| InChIKey | QRGAIUBMWSRIBD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide?
The IUPAC name of 5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide (CID 162792864) is 5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide.
What is the SMILES notation for 5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide?
The canonical SMILES for 5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide is COCC1CC(NC(=O)c2cc(C(C)(C)C)oc2C)C(O)C1O.
What is the InChIKey of 5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide?
The InChIKey is QRGAIUBMWSRIBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO5/c1-9-11(7-13(23-9)17(2,3)4)16(21)18-12-6-10(8-22-5)14(19)15(12)20/h7,10,12,14-15,19-20H,6,8H2,1-5H3,(H,18,21).
What are the key properties of 5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide?
5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide has a molecular weight of 325.41 g/mol, XLogP of 1.37, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-N-[2,3-dihydroxy-4-(methoxymethyl)cyclopentyl]-2-methylfuran-3-carboxamide is sourced from PubChem (CID 162792864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).