C16H28N2O5 — CID 162792883
2-[6-hydroxy-5-[(propan-2-ylamino)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-1-morpholin-4-ylethanone (PubChem CID 162792883) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-[6-hydroxy-5-[(propan-2-ylamino)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[6-hydroxy-5-[(propan-2-ylamino)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 162792883 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-[6-hydroxy-5-[(propan-2-ylamino)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-1-morpholin-4-ylethanone |
| SMILES | CC(C)NCC1OC2CC(CC(=O)N3CCOCC3)OC2C1O |
| InChI | InChI=1S/C16H28N2O5/c1-10(2)17-9-13-15(20)16-12(23-13)7-11(22-16)8-14(19)18-3-5-21-6-4-18/h10-13,15-17,20H,3-9H2,1-2H3 |
| InChIKey | HXDIXAGYTHXFBO-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |