C26H28N2O6 — CID 162793506
2-[(2S)-2-[(2-amino-4-pyridinyl)methyl]-7-oxo-3H-furo[3,2-g]chromen-2-yl]propan-2-yl (E)-2-(2-hydroxyethyl)but-2-enoate (PubChem CID 162793506) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is 2-[(2S)-2-[(2-amino-4-pyridinyl)methyl]-7-oxo-3H-furo[3,2-g]chromen-2-yl]propan-2-yl (E)-2-(2-hydroxyethyl)but-2-enoate.
| Compound Name | 2-[(2S)-2-[(2-amino-4-pyridinyl)methyl]-7-oxo-3H-furo[3,2-g]chromen-2-yl]propan-2-yl (E)-2-(2-hydroxyethyl)but-2-enoate |
|---|---|
| PubChem CID | 162793506 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 2-[(2S)-2-[(2-amino-4-pyridinyl)methyl]-7-oxo-3H-furo[3,2-g]chromen-2-yl]propan-2-yl (E)-2-(2-hydroxyethyl)but-2-enoate |
| SMILES | C/C=C(\CCO)C(=O)OC(C)(C)[C@]1(Cc2ccnc(N)c2)Cc2cc3ccc(=O)oc3cc2O1 |
| InChI | InChI=1S/C26H28N2O6/c1-4-17(8-10-29)24(31)34-25(2,3)26(14-16-7-9-28-22(27)11-16)15-19-12-18-5-6-23(30)32-20(18)13-21(19)33-26/h4-7,9,11-13,29H,8,10,14-15H2,1-3H3,(H2,27,28)/b17-4+/t26-/m0/s1 |
| InChIKey | FXXXILWHRJTRFZ-KABJVABESA-N |
| XLogP | 3.34 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|