C34H37N3O6 — CID 162793955
[5'-[2-amino-5-[2-(3-ethylazetidin-1-yl)-2-oxoethyl]-4-pyridinyl]-1'-methyl-7-oxospiro[3H-furo[3,2-g]chromene-2,6'-cyclohex-3-ene]-1'-yl] 2-methylbut-2-enoate (PubChem CID 162793955) has the molecular formula C34H37N3O6 and a molecular weight of 583.69 g/mol. Its IUPAC name is [5'-[2-amino-5-[2-(3-ethylazetidin-1-yl)-2-oxoethyl]-4-pyridinyl]-1'-methyl-7-oxospiro[3H-furo[3,2-g]chromene-2,6'-cyclohex-3-ene]-1'-yl] 2-methylbut-2-enoate.
| Compound Name | [5'-[2-amino-5-[2-(3-ethylazetidin-1-yl)-2-oxoethyl]-4-pyridinyl]-1'-methyl-7-oxospiro[3H-furo[3,2-g]chromene-2,6'-cyclohex-3-ene]-1'-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162793955 |
| Molecular Formula | C34H37N3O6 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | [5'-[2-amino-5-[2-(3-ethylazetidin-1-yl)-2-oxoethyl]-4-pyridinyl]-1'-methyl-7-oxospiro[3H-furo[3,2-g]chromene-2,6'-cyclohex-3-ene]-1'-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1(C)CC=CC(c2cc(N)ncc2CC(=O)N2CC(CC)C2)C12Cc1cc3ccc(=O)oc3cc1O2 |
| InChI | InChI=1S/C34H37N3O6/c1-5-20(3)32(40)43-33(4)11-7-8-26(25-14-29(35)36-17-24(25)13-30(38)37-18-21(6-2)19-37)34(33)16-23-12-22-9-10-31(39)41-27(22)15-28(23)42-34/h5,7-10,12,14-15,17,21,26H,6,11,13,16,18-19H2,1-4H3,(H2,35,36) |
| InChIKey | NFSMJIVAIDORSC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|