C27H37N3O7S2 — CID 162794663
2-[(4R,12R,14R)-7-cyclopentyloxy-12-hydroxy-10-(2-hydroxyethyl)-4-(2-hydroxypropan-2-yl)-9-oxo-3,20-dioxa-16,17-dithiatetracyclo[9.7.2.02,6.08,19]icosa-1(19),2(6),7,10-tetraen-14-yl]guanidine (PubChem CID 162794663) has the molecular formula C27H37N3O7S2 and a molecular weight of 579.74 g/mol. Its IUPAC name is 2-[(4R,12R,14R)-7-cyclopentyloxy-12-hydroxy-10-(2-hydroxyethyl)-4-(2-hydroxypropan-2-yl)-9-oxo-3,20-dioxa-16,17-dithiatetracyclo[9.7.2.02,6.08,19]icosa-1(19),2(6),7,10-tetraen-14-yl]guanidine.
| Compound Name | 2-[(4R,12R,14R)-7-cyclopentyloxy-12-hydroxy-10-(2-hydroxyethyl)-4-(2-hydroxypropan-2-yl)-9-oxo-3,20-dioxa-16,17-dithiatetracyclo[9.7.2.02,6.08,19]icosa-1(19),2(6),7,10-tetraen-14-yl]guanidine |
|---|---|
| PubChem CID | 162794663 |
| Molecular Formula | C27H37N3O7S2 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | 2-[(4R,12R,14R)-7-cyclopentyloxy-12-hydroxy-10-(2-hydroxyethyl)-4-(2-hydroxypropan-2-yl)-9-oxo-3,20-dioxa-16,17-dithiatetracyclo[9.7.2.02,6.08,19]icosa-1(19),2(6),7,10-tetraen-14-yl]guanidine |
| SMILES | CC(C)(O)[C@H]1Cc2c(c3c4oc(c(CCO)c(=O)c4c2OC2CCCC2)[C@H](O)C[C@@H](N=C(N)N)CSSC3)O1 |
| InChI | InChI=1S/C27H37N3O7S2/c1-27(2,34)19-10-16-22(36-19)17-12-39-38-11-13(30-26(28)29)9-18(32)23-15(7-8-31)21(33)20(25(17)37-23)24(16)35-14-5-3-4-6-14/h13-14,18-19,31-32,34H,3-12H2,1-2H3,(H4,28,29,30)/t13-,18-,19-/m1/s1 |
| InChIKey | HSQNGDUTCPEXHN-UPRAQXHNSA-N |
| XLogP | 2.68 |
| TPSA | 173.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|