C32H35N2O5- — CID 162795524
6-hydroxy-19-(indol-1-id-3-ylmethyl)-7,9,16,17-tetramethyl-15-oxa-20-azapentacyclo[11.8.0.01,18.04,8.014,16]henicosa-6,11-diene-2,5,21-trione (PubChem CID 162795524) has the molecular formula C32H35N2O5- and a molecular weight of 527.64 g/mol. Its IUPAC name is 6-hydroxy-19-(indol-1-id-3-ylmethyl)-7,9,16,17-tetramethyl-15-oxa-20-azapentacyclo[11.8.0.01,18.04,8.014,16]henicosa-6,11-diene-2,5,21-trione.
| Compound Name | 6-hydroxy-19-(indol-1-id-3-ylmethyl)-7,9,16,17-tetramethyl-15-oxa-20-azapentacyclo[11.8.0.01,18.04,8.014,16]henicosa-6,11-diene-2,5,21-trione |
|---|---|
| PubChem CID | 162795524 |
| Molecular Formula | C32H35N2O5- |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 6-hydroxy-19-(indol-1-id-3-ylmethyl)-7,9,16,17-tetramethyl-15-oxa-20-azapentacyclo[11.8.0.01,18.04,8.014,16]henicosa-6,11-diene-2,5,21-trione |
| SMILES | CC1=C(O)C(=O)C2CC(=O)C34C(=O)NC(Cc5c[n-]c6ccccc56)C3C(C)C3(C)OC3C4C=CCC(C)C12 |
| InChI | InChI=1S/C32H35N2O5/c1-15-8-7-10-21-29-31(4,39-29)17(3)26-23(12-18-14-33-22-11-6-5-9-19(18)22)34-30(38)32(21,26)24(35)13-20-25(15)16(2)27(36)28(20)37/h5-7,9-11,14-15,17,20-21,23,25-26,29,36H,8,12-13H2,1-4H3,(H,34,38)/q-1 |
| InChIKey | DHEVWDJEWSCIBH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|