C25H33N5O5 — CID 162795944
5-[[(3S,3aS,6R,6aR)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]amino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 162795944) has the molecular formula C25H33N5O5 and a molecular weight of 483.57 g/mol. Its IUPAC name is 5-[[(3S,3aS,6R,6aR)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]amino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[[(3S,3aS,6R,6aR)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]amino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 162795944 |
| Molecular Formula | C25H33N5O5 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 5-[[(3S,3aS,6R,6aR)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]amino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CN(C)c1ccc(-c2ccnc(N[C@H]3CO[C@H]4[C@H]3OC[C@H]4NC(=O)CC(C)(C)CC(=O)O)n2)cc1 |
| InChI | InChI=1S/C25H33N5O5/c1-25(2,12-21(32)33)11-20(31)27-18-13-34-23-19(14-35-22(18)23)29-24-26-10-9-17(28-24)15-5-7-16(8-6-15)30(3)4/h5-10,18-19,22-23H,11-14H2,1-4H3,(H,27,31)(H,32,33)(H,26,28,29)/t18-,19+,22-,23+/m1/s1 |
| InChIKey | WTVRZTJAKXZVPA-VNHKHXMHSA-N |
| XLogP | 2.16 |
| TPSA | 125.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |