C40H58N8O8 — CID 162796516
24-benzyl-15,27-di(butan-2-yl)-1,7,13,16,19,22,25,28-octazatetracyclo[28.3.0.03,7.09,13]tritriacontane-2,8,14,17,20,23,26,29-octone (PubChem CID 162796516) has the molecular formula C40H58N8O8 and a molecular weight of 778.95 g/mol. Its IUPAC name is 24-benzyl-15,27-di(butan-2-yl)-1,7,13,16,19,22,25,28-octazatetracyclo[28.3.0.03,7.09,13]tritriacontane-2,8,14,17,20,23,26,29-octone.
| Compound Name | 24-benzyl-15,27-di(butan-2-yl)-1,7,13,16,19,22,25,28-octazatetracyclo[28.3.0.03,7.09,13]tritriacontane-2,8,14,17,20,23,26,29-octone |
|---|---|
| PubChem CID | 162796516 |
| Molecular Formula | C40H58N8O8 |
| Molecular Weight | 778.95 g/mol |
| Exact Mass | 778.44 |
| IUPAC Name | 24-benzyl-15,27-di(butan-2-yl)-1,7,13,16,19,22,25,28-octazatetracyclo[28.3.0.03,7.09,13]tritriacontane-2,8,14,17,20,23,26,29-octone |
| SMILES | CCC(C)C1NC(=O)C2CCCN2C(=O)C2CCCN2C(=O)C2CCCN2C(=O)C(C(C)CC)NC(=O)CNC(=O)CNC(=O)C(Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C40H58N8O8/c1-5-24(3)33-37(53)43-27(21-26-13-8-7-9-14-26)35(51)42-22-31(49)41-23-32(50)44-34(25(4)6-2)40(56)48-20-12-17-30(48)39(55)47-19-11-16-29(47)38(54)46-18-10-15-28(46)36(52)45-33/h7-9,13-14,24-25,27-30,33-34H,5-6,10-12,15-23H2,1-4H3,(H,41,49)(H,42,51)(H,43,53)(H,44,50)(H,45,52) |
| InChIKey | YCVRPTIOEDOFFO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 206.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.95 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |