About N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide
N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide (PubChem CID 162796903) has the molecular formula C14H25NO5
and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide |
| PubChem CID | 162796903 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide |
| SMILES | COCCOCC1(CNC(=O)C2CC2)CC(O)C(O)C1 |
| InChI | InChI=1S/C14H25NO5/c1-19-4-5-20-9-14(6-11(16)12(17)7-14)8-15-13(18)10-2-3-10/h10-12,16-17H,2-9H2,1H3,(H,15,18) |
| InChIKey | HUTOHYICWDGSEO-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide?
The IUPAC name of N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide (CID 162796903) is N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide.
What is the SMILES notation for N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide?
The canonical SMILES for N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide is COCCOCC1(CNC(=O)C2CC2)CC(O)C(O)C1.
What is the InChIKey of N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide?
The InChIKey is HUTOHYICWDGSEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO5/c1-19-4-5-20-9-14(6-11(16)12(17)7-14)8-15-13(18)10-2-3-10/h10-12,16-17H,2-9H2,1H3,(H,15,18).
What are the key properties of N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide?
N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide has a molecular weight of 287.36 g/mol, XLogP of -0.32, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide is sourced from PubChem (CID 162796903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).