C27H34FN5 — CID 162797024
4-[[[(2R,4S,5S)-5-[3-(4-fluorophenyl)-1-methylpyrazol-5-yl]-1-azabicyclo[2.2.2]octan-2-yl]methylamino]methyl]-N,N-dimethylaniline (PubChem CID 162797024) has the molecular formula C27H34FN5 and a molecular weight of 447.60 g/mol. Its IUPAC name is 4-[[[(2R,4S,5S)-5-[3-(4-fluorophenyl)-1-methylpyrazol-5-yl]-1-azabicyclo[2.2.2]octan-2-yl]methylamino]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[[(2R,4S,5S)-5-[3-(4-fluorophenyl)-1-methylpyrazol-5-yl]-1-azabicyclo[2.2.2]octan-2-yl]methylamino]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 162797024 |
| Molecular Formula | C27H34FN5 |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | 4-[[[(2R,4S,5S)-5-[3-(4-fluorophenyl)-1-methylpyrazol-5-yl]-1-azabicyclo[2.2.2]octan-2-yl]methylamino]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CNC[C@H]2C[C@@H]3CCN2C[C@H]3c2cc(-c3ccc(F)cc3)nn2C)cc1 |
| InChI | InChI=1S/C27H34FN5/c1-31(2)23-10-4-19(5-11-23)16-29-17-24-14-21-12-13-33(24)18-25(21)27-15-26(30-32(27)3)20-6-8-22(28)9-7-20/h4-11,15,21,24-25,29H,12-14,16-18H2,1-3H3/t21-,24+,25+/m0/s1 |
| InChIKey | ZZQCNNHAICPHEC-FTBPSBKWSA-N |
| XLogP | 4.26 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|