C14H18N2O2S2 — CID 162797048
N-[[(2R,4S,5R)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiophene-2-sulfonamide (PubChem CID 162797048) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is N-[[(2R,4S,5R)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-[[(2R,4S,5R)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 162797048 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-[[(2R,4S,5R)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiophene-2-sulfonamide |
| SMILES | C#C[C@@H]1CN2CC[C@H]1C[C@@H]2CNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H18N2O2S2/c1-2-11-10-16-6-5-12(11)8-13(16)9-15-20(17,18)14-4-3-7-19-14/h1,3-4,7,11-13,15H,5-6,8-10H2/t11-,12+,13-/m1/s1 |
| InChIKey | ULZPJRCRHCQJJU-FRRDWIJNSA-N |
| XLogP | 1.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|