C21H28N6O3 — CID 162797178
(3S,4S,6R)-N-(2-acetamidoethyl)-6-[[4-(3-hydroxyphenyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide (PubChem CID 162797178) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is (3S,4S,6R)-N-(2-acetamidoethyl)-6-[[4-(3-hydroxyphenyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide.
| Compound Name | (3S,4S,6R)-N-(2-acetamidoethyl)-6-[[4-(3-hydroxyphenyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide |
|---|---|
| PubChem CID | 162797178 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (3S,4S,6R)-N-(2-acetamidoethyl)-6-[[4-(3-hydroxyphenyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide |
| SMILES | CC(=O)NCCNC(=O)[C@@H]1CN2CC[C@H]1C[C@@H]2Cn1cc(-c2cccc(O)c2)nn1 |
| InChI | InChI=1S/C21H28N6O3/c1-14(28)22-6-7-23-21(30)19-12-26-8-5-15(19)9-17(26)11-27-13-20(24-25-27)16-3-2-4-18(29)10-16/h2-4,10,13,15,17,19,29H,5-9,11-12H2,1H3,(H,22,28)(H,23,30)/t15-,17+,19+/m0/s1 |
| InChIKey | QJEBGSHQMVBBHH-KVSKMBFKSA-N |
| XLogP | 0.61 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|