C17H19N5O2 — CID 162797844
N-[(6-methoxy-2-pyridinyl)methyl]-1-(11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl)methanamine (PubChem CID 162797844) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[(6-methoxy-2-pyridinyl)methyl]-1-(11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl)methanamine.
| Compound Name | N-[(6-methoxy-2-pyridinyl)methyl]-1-(11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl)methanamine |
|---|---|
| PubChem CID | 162797844 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-[(6-methoxy-2-pyridinyl)methyl]-1-(11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl)methanamine |
| SMILES | COc1cccc(CNCC2COCc3nc4cccnc4n32)n1 |
| InChI | InChI=1S/C17H19N5O2/c1-23-16-6-2-4-12(20-16)8-18-9-13-10-24-11-15-21-14-5-3-7-19-17(14)22(13)15/h2-7,13,18H,8-11H2,1H3 |
| InChIKey | XKYQMOJWYRYXBF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |