C11H18N2O2S — CID 162798872
4-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1,4-oxazepan-6-ol (PubChem CID 162798872) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 4-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1,4-oxazepan-6-ol.
| Compound Name | 4-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 162798872 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1,4-oxazepan-6-ol |
| SMILES | Cc1nc(C)c(CN2CCOCC(O)C2)s1 |
| InChI | InChI=1S/C11H18N2O2S/c1-8-11(16-9(2)12-8)6-13-3-4-15-7-10(14)5-13/h10,14H,3-7H2,1-2H3 |
| InChIKey | MHGGACJIWLUAOC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |